C23H26N4O3S — CID 37280085
N-[4-[(E)-3-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide (PubChem CID 37280085) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[4-[(E)-3-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-3-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 37280085 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[4-[(E)-3-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)N2CCCN(Cc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-31(29,30)25-22-10-7-19(8-11-22)9-12-23(28)27-14-2-13-26(15-16-27)18-21-5-3-20(17-24)4-6-21/h3-12,25H,2,13-16,18H2,1H3/b12-9+ |
| InChIKey | IGJHVDDQILBAMF-FMIVXFBMSA-N |
| XLogP | 2.68 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|