C22H24F3N3O3S — CID 31293430
N-[4-[(E)-3-oxo-3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]methanesulfonamide (PubChem CID 31293430) has the molecular formula C22H24F3N3O3S and a molecular weight of 467.51 g/mol. Its IUPAC name is N-[4-[(E)-3-oxo-3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-3-oxo-3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 31293430 |
| Molecular Formula | C22H24F3N3O3S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[4-[(E)-3-oxo-3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)N2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24F3N3O3S/c1-32(30,31)26-20-9-4-17(5-10-20)6-11-21(29)28-14-12-27(13-15-28)16-18-2-7-19(8-3-18)22(23,24)25/h2-11,26H,12-16H2,1H3/b11-6+ |
| InChIKey | PQIQRPFMBVYZLJ-IZZDOVSWSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|