C16H19F3N2O3S — CID 37090399
N-[4-[(E)-3-oxo-3-[(3S)-3-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]phenyl]methanesulfonamide (PubChem CID 37090399) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is N-[4-[(E)-3-oxo-3-[(3S)-3-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-3-oxo-3-[(3S)-3-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 37090399 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[4-[(E)-3-oxo-3-[(3S)-3-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)N2CCC[C@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C16H19F3N2O3S/c1-25(23,24)20-14-7-4-12(5-8-14)6-9-15(22)21-10-2-3-13(11-21)16(17,18)19/h4-9,13,20H,2-3,10-11H2,1H3/b9-6+/t13-/m0/s1 |
| InChIKey | IHEATMNIRXRIAJ-PPGNKHEKSA-N |
| XLogP | 2.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|