C19H20F3NO2 — CID 24652476
(E)-3-(2-ethyl-1-benzofuran-3-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 24652476) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is (E)-3-(2-ethyl-1-benzofuran-3-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24652476 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C19H20F3NO2/c1-2-16-15(14-7-3-4-8-17(14)25-16)9-10-18(24)23-11-5-6-13(12-23)19(20,21)22/h3-4,7-10,13H,2,5-6,11-12H2,1H3/b10-9+ |
| InChIKey | BKDJDKVABBEBDP-MDZDMXLPSA-N |
| XLogP | 4.81 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|