C21H27N2O4S+ — CID 8530294
(E)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one (PubChem CID 8530294) has the molecular formula C21H27N2O4S+ and a molecular weight of 403.52 g/mol. Its IUPAC name is (E)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8530294 |
| Molecular Formula | C21H27N2O4S+ |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (E)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)N1CC[NH+]([C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C21H26N2O4S/c1-2-19-18(17-5-3-4-6-20(17)27-19)7-8-21(24)23-12-10-22(11-13-23)16-9-14-28(25,26)15-16/h3-8,16H,2,9-15H2,1H3/p+1/b8-7+/t16-/m0/s1 |
| InChIKey | BICWITFNTRKJNV-WAVCKPEOSA-O |
| XLogP | 0.92 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|