C18H21NO4S — CID 51238417
(E)-N-(1,1-dioxothiolan-3-yl)-3-(2-ethyl-1-benzofuran-3-yl)-N-methylprop-2-enamide (PubChem CID 51238417) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-(2-ethyl-1-benzofuran-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(2-ethyl-1-benzofuran-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 51238417 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(2-ethyl-1-benzofuran-3-yl)-N-methylprop-2-enamide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21NO4S/c1-3-16-15(14-6-4-5-7-17(14)23-16)8-9-18(20)19(2)13-10-11-24(21,22)12-13/h4-9,13H,3,10-12H2,1-2H3/b9-8+ |
| InChIKey | SSIGFXHLTQGOIJ-CMDGGOBGSA-N |
| XLogP | 2.65 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|