C12H15NO3S2 — CID 51238375
(E)-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 51238375) has the molecular formula C12H15NO3S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 51238375 |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1cccs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO3S2/c1-13(10-6-8-18(15,16)9-10)12(14)5-4-11-3-2-7-17-11/h2-5,7,10H,6,8-9H2,1H3/b5-4+ |
| InChIKey | YSAIZRRSYAXADS-SNAWJCMRSA-N |
| XLogP | 1.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|