C16H18N2O5S3 — CID 4870112
N-(1,1-dioxothiolan-3-yl)-3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-methylpropanamide (PubChem CID 4870112) has the molecular formula C16H18N2O5S3 and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-methylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 4870112 |
| Molecular Formula | C16H18N2O5S3 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)SC(=Cc2cccs2)C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O5S3/c1-17(11-5-8-26(22,23)10-11)14(19)4-6-18-15(20)13(25-16(18)21)9-12-3-2-7-24-12/h2-3,7,9,11H,4-6,8,10H2,1H3 |
| InChIKey | JXXVOXTXZFUIES-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|