C16H18N2O6S2 — CID 4895636
N-(1,1-dioxothiolan-3-yl)-3-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide (PubChem CID 4895636) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 4895636 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)SC(=Cc2ccco2)C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O6S2/c1-17(11-5-8-26(22,23)10-11)14(19)4-6-18-15(20)13(25-16(18)21)9-12-3-2-7-24-12/h2-3,7,9,11H,4-6,8,10H2,1H3 |
| InChIKey | PIPWAEPNMQMUQK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|