C18H19FN2O5S2 — CID 41067744
N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(5E)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide (PubChem CID 41067744) has the molecular formula C18H19FN2O5S2 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(5E)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(5E)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 41067744 |
| Molecular Formula | C18H19FN2O5S2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(5E)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)S/C(=C/c2cccc(F)c2)C1=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H19FN2O5S2/c1-20(14-6-8-28(25,26)11-14)16(22)5-7-21-17(23)15(27-18(21)24)10-12-3-2-4-13(19)9-12/h2-4,9-10,14H,5-8,11H2,1H3/b15-10+/t14-/m0/s1 |
| InChIKey | HWDWJIAVOHSXBA-GWQWUEFDSA-N |
| XLogP | 1.90 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|