C17H17FN2O5S2 — CID 41029346
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylacetamide (PubChem CID 41029346) has the molecular formula C17H17FN2O5S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 41029346 |
| Molecular Formula | C17H17FN2O5S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)S/C(=C\c2cccc(F)c2)C1=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H17FN2O5S2/c1-19(13-5-6-27(24,25)10-13)15(21)9-20-16(22)14(26-17(20)23)8-11-3-2-4-12(18)7-11/h2-4,7-8,13H,5-6,9-10H2,1H3/b14-8-/t13-/m0/s1 |
| InChIKey | VEVUOPBTONRLDT-IAOKNECISA-N |
| XLogP | 1.51 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|