C17H18N2O5S2 — CID 6389654
2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 6389654) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 6389654 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)S/C(=C/c2ccccc2)C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18N2O5S2/c1-18(13-7-8-26(23,24)11-13)15(20)10-19-16(21)14(25-17(19)22)9-12-5-3-2-4-6-12/h2-6,9,13H,7-8,10-11H2,1H3/b14-9+ |
| InChIKey | RXRMNGKGQNSFIY-NTEUORMPSA-N |
| XLogP | 1.37 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|