C17H20N2O4S4 — CID 4969887
N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide (PubChem CID 4969887) has the molecular formula C17H20N2O4S4 and a molecular weight of 444.63 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 4969887 |
| Molecular Formula | C17H20N2O4S4 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
| SMILES | CCN(C(=O)CCN1C(=O)C(=Cc2cccs2)SC1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20N2O4S4/c1-2-18(12-6-9-27(22,23)11-12)15(20)5-7-19-16(21)14(26-17(19)24)10-13-4-3-8-25-13/h3-4,8,10,12H,2,5-7,9,11H2,1H3 |
| InChIKey | OKGPVVZOVLOWNP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|