C21H26N2O5S3 — CID 50739559
N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 50739559) has the molecular formula C21H26N2O5S3 and a molecular weight of 482.65 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 50739559 |
| Molecular Formula | C21H26N2O5S3 |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CCN(C(=O)CCCN1C(=O)/C(=C/c2ccc(OC)cc2)SC1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26N2O5S3/c1-3-22(16-10-12-31(26,27)14-16)19(24)5-4-11-23-20(25)18(30-21(23)29)13-15-6-8-17(28-2)9-7-15/h6-9,13,16H,3-5,10-12,14H2,1-2H3/b18-13- |
| InChIKey | SNZDMFKZYXHBOC-AQTBWJFISA-N |
| XLogP | 2.71 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|