C25H25ClN2O5S3 — CID 45128805
N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 45128805) has the molecular formula C25H25ClN2O5S3 and a molecular weight of 565.14 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 45128805 |
| Molecular Formula | C25H25ClN2O5S3 |
| Molecular Weight | 565.14 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCC(=O)N(Cc3ccc(Cl)cc3)C3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C25H25ClN2O5S3/c1-33-21-8-4-17(5-9-21)14-22-24(30)27(25(34)35-22)12-10-23(29)28(20-11-13-36(31,32)16-20)15-18-2-6-19(26)7-3-18/h2-9,14,20H,10-13,15-16H2,1H3/b22-14- |
| InChIKey | XQJHKYRIELVDEX-HMAPJEAMSA-N |
| XLogP | 4.16 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|