C22H21FN2O5S3 — CID 18880230
N-(1,1-dioxothiolan-3-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 18880230) has the molecular formula C22H21FN2O5S3 and a molecular weight of 508.62 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 18880230 |
| Molecular Formula | C22H21FN2O5S3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(C(=O)CN2C(=O)/C(=C/c3ccc(F)cc3)SC2=S)C2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C22H21FN2O5S3/c1-14-2-7-18(30-14)11-24(17-8-9-33(28,29)13-17)20(26)12-25-21(27)19(32-22(25)31)10-15-3-5-16(23)6-4-15/h2-7,10,17H,8-9,11-13H2,1H3/b19-10- |
| InChIKey | ZXRPPNUXDKRGEI-GRSHGNNSSA-N |
| XLogP | 3.14 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|