C23H22ClFN2O4S4 — CID 18884184
N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide (PubChem CID 18884184) has the molecular formula C23H22ClFN2O4S4 and a molecular weight of 573.16 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 18884184 |
| Molecular Formula | C23H22ClFN2O4S4 |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C1/C(=C/c2cccs2)SC(=S)N1CCCC(=O)N(Cc1c(F)cccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H22ClFN2O4S4/c24-18-5-1-6-19(25)17(18)13-27(15-8-11-35(30,31)14-15)21(28)7-2-9-26-22(29)20(34-23(26)32)12-16-4-3-10-33-16/h1,3-6,10,12,15H,2,7-9,11,13-14H2/b20-12- |
| InChIKey | YAQBKDXEHNEBKQ-NDENLUEZSA-N |
| XLogP | 4.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|