C15H18BrNO4S — CID 51238328
(E)-3-(5-bromo-2-methoxyphenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide (PubChem CID 51238328) has the molecular formula C15H18BrNO4S and a molecular weight of 388.28 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 51238328 |
| Molecular Formula | C15H18BrNO4S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18BrNO4S/c1-17(13-7-8-22(19,20)10-13)15(18)6-3-11-9-12(16)4-5-14(11)21-2/h3-6,9,13H,7-8,10H2,1-2H3/b6-3+ |
| InChIKey | HKVKTLAFRHJBKO-ZZXKWVIFSA-N |
| XLogP | 2.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|