C16H17BrFNO3S — CID 55464928
(E)-3-(5-bromo-2-fluorophenyl)-N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 55464928) has the molecular formula C16H17BrFNO3S and a molecular weight of 402.29 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55464928 |
| Molecular Formula | C16H17BrFNO3S |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)N(C1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17BrFNO3S/c17-12-2-5-15(18)11(9-12)1-6-16(20)19(13-3-4-13)14-7-8-23(21,22)10-14/h1-2,5-6,9,13-14H,3-4,7-8,10H2/b6-1+ |
| InChIKey | LMUIEQPKVMRIJZ-LZCJLJQNSA-N |
| XLogP | 2.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|