C16H20FNO3S — CID 25471531
N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-fluorobenzamide (PubChem CID 25471531) has the molecular formula C16H20FNO3S and a molecular weight of 325.40 g/mol. Its IUPAC name is N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-fluorobenzamide.
| Compound Name | N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 25471531 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-fluorobenzamide |
| SMILES | O=C(c1cccc(F)c1)N(C1CCCC1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20FNO3S/c17-13-5-3-4-12(10-13)16(19)18(14-6-1-2-7-14)15-8-9-22(20,21)11-15/h3-5,10,14-15H,1-2,6-9,11H2/t15-/m1/s1 |
| InChIKey | HZYCGQJJOUXNBP-OAHLLOKOSA-N |
| XLogP | 2.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |