C16H19F2NO3S — CID 42940163
N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3,5-difluorobenzamide (PubChem CID 42940163) has the molecular formula C16H19F2NO3S and a molecular weight of 343.40 g/mol. Its IUPAC name is N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3,5-difluorobenzamide.
| Compound Name | N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 42940163 |
| Molecular Formula | C16H19F2NO3S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3,5-difluorobenzamide |
| SMILES | O=C(c1cc(F)cc(F)c1)N(C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H19F2NO3S/c17-12-7-11(8-13(18)9-12)16(20)19(14-3-1-2-4-14)15-5-6-23(21,22)10-15/h7-9,14-15H,1-6,10H2 |
| InChIKey | OZJNIUZBSRFJGX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |