C14H16FNO3S — CID 60605416
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide (PubChem CID 60605416) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide.
| Compound Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 60605416 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide |
| SMILES | O=C(c1ccccc1F)N(C1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16FNO3S/c15-13-4-2-1-3-12(13)14(17)16(10-5-6-10)11-7-8-20(18,19)9-11/h1-4,10-11H,5-9H2 |
| InChIKey | DMKGYGRVZUCJSN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |