C19H21FN2O3S — CID 112984282
N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]-2-fluorobenzamide (PubChem CID 112984282) has the molecular formula C19H21FN2O3S and a molecular weight of 376.45 g/mol. Its IUPAC name is N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 112984282 |
| Molecular Formula | C19H21FN2O3S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]-2-fluorobenzamide |
| SMILES | CCN(c1ccc(NC(=O)c2ccccc2F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21FN2O3S/c1-2-22(16-11-12-26(24,25)13-16)15-9-7-14(8-10-15)21-19(23)17-5-3-4-6-18(17)20/h3-10,16H,2,11-13H2,1H3,(H,21,23) |
| InChIKey | XZXMZJRAKPKHPM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |