C18H20ClN3O3S — CID 113029205
2-chloro-N-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]benzamide (PubChem CID 113029205) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is 2-chloro-N-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]benzamide.
| Compound Name | 2-chloro-N-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113029205 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-chloro-N-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]benzamide |
| SMILES | CCN(c1ccc(NC(=O)c2ccccc2Cl)nc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-2-22(14-9-10-26(24,25)12-14)13-7-8-17(20-11-13)21-18(23)15-5-3-4-6-16(15)19/h3-8,11,14H,2,9-10,12H2,1H3,(H,20,21,23) |
| InChIKey | IBRXPCCYAJGPQS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |