C15H22N4O3S — CID 113029223
1-cyclopropyl-3-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]urea (PubChem CID 113029223) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]urea.
| Compound Name | 1-cyclopropyl-3-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]urea |
|---|---|
| PubChem CID | 113029223 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-cyclopropyl-3-[5-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-pyridinyl]urea |
| SMILES | CCN(c1ccc(NC(=O)NC2CC2)nc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22N4O3S/c1-2-19(13-7-8-23(21,22)10-13)12-5-6-14(16-9-12)18-15(20)17-11-3-4-11/h5-6,9,11,13H,2-4,7-8,10H2,1H3,(H2,16,17,18,20) |
| InChIKey | FNUOWZKJSQNXJY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |