C13H20N2O2S — CID 54914556
N-[4-(aminomethyl)phenyl]-N-ethyl-1,1-dioxothiolan-3-amine (PubChem CID 54914556) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-N-ethyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-[4-(aminomethyl)phenyl]-N-ethyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 54914556 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-N-ethyl-1,1-dioxothiolan-3-amine |
| SMILES | CCN(c1ccc(CN)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N2O2S/c1-2-15(13-7-8-18(16,17)10-13)12-5-3-11(9-14)4-6-12/h3-6,13H,2,7-10,14H2,1H3 |
| InChIKey | SQISBHHFWUPFKU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|