C17H26N2O4S — CID 112984308
tert-butyl N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]carbamate (PubChem CID 112984308) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is tert-butyl N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 112984308 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]carbamate |
| SMILES | CCN(c1ccc(NC(=O)OC(C)(C)C)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O4S/c1-5-19(15-10-11-24(21,22)12-15)14-8-6-13(7-9-14)18-16(20)23-17(2,3)4/h6-9,15H,5,10-12H2,1-4H3,(H,18,20) |
| InChIKey | IDYJEFJLKPHZOI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |