C16H26N2O4S2 — CID 112984316
N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]butane-1-sulfonamide (PubChem CID 112984316) has the molecular formula C16H26N2O4S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]butane-1-sulfonamide.
| Compound Name | N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 112984316 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[4-[(1,1-dioxothiolan-3-yl)-ethylamino]phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(N(CC)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H26N2O4S2/c1-3-5-11-24(21,22)17-14-6-8-15(9-7-14)18(4-2)16-10-12-23(19,20)13-16/h6-9,16-17H,3-5,10-13H2,1-2H3 |
| InChIKey | VFYLPNORKSTSFI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |