C15H23NO4S2 — CID 110757494
4-butyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide (PubChem CID 110757494) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-butyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-butyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110757494 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-butyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H23NO4S2/c1-3-4-5-13-6-8-15(9-7-13)22(19,20)16(2)14-10-11-21(17,18)12-14/h6-9,14H,3-5,10-12H2,1-2H3 |
| InChIKey | JUKFDMNRCRDCPQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |