C13H17NO5S2 — CID 3738114
4-acetyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide (PubChem CID 3738114) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-acetyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-acetyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3738114 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-acetyl-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO5S2/c1-10(15)11-3-5-13(6-4-11)21(18,19)14(2)12-7-8-20(16,17)9-12/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | LGHNOLXQTJSBIN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |