C12H16BrNO4S2 — CID 65481783
4-(bromomethyl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide (PubChem CID 65481783) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 65481783 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 4-(bromomethyl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C12H16BrNO4S2/c1-14(11-6-7-19(15,16)9-11)20(17,18)12-4-2-10(8-13)3-5-12/h2-5,11H,6-9H2,1H3 |
| InChIKey | WDBKBUAMELWTRA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|