C12H16ClNO4S2 — CID 47190072
3-chloro-N-(1,1-dioxothiolan-3-yl)-N,4-dimethylbenzenesulfonamide (PubChem CID 47190072) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxothiolan-3-yl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 47190072 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C12H16ClNO4S2/c1-9-3-4-11(7-12(9)13)20(17,18)14(2)10-5-6-19(15,16)8-10/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | GKMGTMXOOQHUMZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |