C12H16FNO4S2 — CID 47190070
N-(1,1-dioxothiolan-3-yl)-5-fluoro-N,2-dimethylbenzenesulfonamide (PubChem CID 47190070) has the molecular formula C12H16FNO4S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-fluoro-N,2-dimethylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-fluoro-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 47190070 |
| Molecular Formula | C12H16FNO4S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-fluoro-N,2-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16FNO4S2/c1-9-3-4-10(13)7-12(9)20(17,18)14(2)11-5-6-19(15,16)8-11/h3-4,7,11H,5-6,8H2,1-2H3 |
| InChIKey | JNWLGPXFTNSXPM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |