C11H15BrN2O4S2 — CID 60988461
2-amino-5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide (PubChem CID 60988461) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60988461 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 2-amino-5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C11H15BrN2O4S2/c1-14(9-4-5-19(15,16)7-9)20(17,18)11-6-8(12)2-3-10(11)13/h2-3,6,9H,4-5,7,13H2,1H3 |
| InChIKey | MNKDBQLQMMBJSG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|