C12H15Br2NO4S2 — CID 129366084
2,5-dibromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylbenzenesulfonamide (PubChem CID 129366084) has the molecular formula C12H15Br2NO4S2 and a molecular weight of 461.20 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 129366084 |
| Molecular Formula | C12H15Br2NO4S2 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 458.88 |
| IUPAC Name | 2,5-dibromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylbenzenesulfonamide |
| SMILES | CCN([C@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H15Br2NO4S2/c1-2-15(10-5-6-20(16,17)8-10)21(18,19)12-7-9(13)3-4-11(12)14/h3-4,7,10H,2,5-6,8H2,1H3/t10-/m0/s1 |
| InChIKey | AQUIEMZMAKVRRO-JTQLQIEISA-N |
| XLogP | 2.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |