C11H15ClN2O4S2 — CID 60716041
2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-3-sulfonamide (PubChem CID 60716041) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60716041 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-3-sulfonamide |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H15ClN2O4S2/c1-2-14(9-5-7-19(15,16)8-9)20(17,18)10-4-3-6-13-11(10)12/h3-4,6,9H,2,5,7-8H2,1H3 |
| InChIKey | ZYKGKROFPSKUQH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|