About 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide
2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 18170868) has the molecular formula C13H15ClF3NO4S2
and a molecular weight of 405.85 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 18170868 |
| Molecular Formula | C13H15ClF3NO4S2 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C13H15ClF3NO4S2/c1-2-18(10-5-6-23(19,20)8-10)24(21,22)12-7-9(13(15,16)17)3-4-11(12)14/h3-4,7,10H,2,5-6,8H2,1H3 |
| InChIKey | XUPIOZATWJIILH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide (CID 18170868) is 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide is CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl.
What is the InChIKey of 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide?
The InChIKey is XUPIOZATWJIILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClF3NO4S2/c1-2-18(10-5-6-23(19,20)8-10)24(21,22)12-7-9(13(15,16)17)3-4-11(12)14/h3-4,7,10H,2,5-6,8H2,1H3.
What are the key properties of 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide?
2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide has a molecular weight of 405.85 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 18170868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).