C12H16BrNO4S2 — CID 51169210
2-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylbenzenesulfonamide (PubChem CID 51169210) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 2-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylbenzenesulfonamide.
| Compound Name | 2-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 51169210 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylbenzenesulfonamide |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H16BrNO4S2/c1-2-14(10-7-8-19(15,16)9-10)20(17,18)12-6-4-3-5-11(12)13/h3-6,10H,2,7-9H2,1H3 |
| InChIKey | VHFUDDIGBMJOMQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |