C11H16N2O4S2 — CID 94151657
N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylpyridine-3-sulfonamide (PubChem CID 94151657) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylpyridine-3-sulfonamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 94151657 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylpyridine-3-sulfonamide |
| SMILES | CCN([C@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-2-13(10-5-7-18(14,15)9-10)19(16,17)11-4-3-6-12-8-11/h3-4,6,8,10H,2,5,7,9H2,1H3/t10-/m0/s1 |
| InChIKey | MTTSQMPLJUEIAP-JTQLQIEISA-N |
| XLogP | 0.28 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |