C13H19ClN2O4S2 — CID 18229386
6-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)pyridine-3-sulfonamide (PubChem CID 18229386) has the molecular formula C13H19ClN2O4S2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 18229386 |
| Molecular Formula | C13H19ClN2O4S2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)pyridine-3-sulfonamide |
| SMILES | CC(C)CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H19ClN2O4S2/c1-10(2)8-16(11-5-6-21(17,18)9-11)22(19,20)12-3-4-13(14)15-7-12/h3-4,7,10-11H,5-6,8-9H2,1-2H3 |
| InChIKey | LREPCTAKZGWCGH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|