C14H22N2O6S3 — CID 18287287
4-N-(1,1-dioxothiolan-3-yl)-4-N-(2-methylpropyl)benzene-1,4-disulfonamide (PubChem CID 18287287) has the molecular formula C14H22N2O6S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-4-N-(2-methylpropyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-(2-methylpropyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 18287287 |
| Molecular Formula | C14H22N2O6S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-(2-methylpropyl)benzene-1,4-disulfonamide |
| SMILES | CC(C)CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O6S3/c1-11(2)9-16(12-7-8-23(17,18)10-12)25(21,22)14-5-3-13(4-6-14)24(15,19)20/h3-6,11-12H,7-10H2,1-2H3,(H2,15,19,20) |
| InChIKey | AWNBEFRTSNSZDB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |