C18H18ClNO6S2 — CID 129360450
3-[benzyl-[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-chlorobenzoic acid (PubChem CID 129360450) has the molecular formula C18H18ClNO6S2 and a molecular weight of 443.93 g/mol. Its IUPAC name is 3-[benzyl-[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-chlorobenzoic acid.
| Compound Name | 3-[benzyl-[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 129360450 |
| Molecular Formula | C18H18ClNO6S2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 3-[benzyl-[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)N(Cc2ccccc2)[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H18ClNO6S2/c19-16-7-6-14(18(21)22)10-17(16)28(25,26)20(11-13-4-2-1-3-5-13)15-8-9-27(23,24)12-15/h1-7,10,15H,8-9,11-12H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | AFRPJHBGNOVPDD-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |