C14H22N2O4S2 — CID 70755777
N-[benzyl(methyl)sulfamoyl]-N-ethyl-1,1-dioxothiolan-3-amine (PubChem CID 70755777) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[benzyl(methyl)sulfamoyl]-N-ethyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-[benzyl(methyl)sulfamoyl]-N-ethyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 70755777 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[benzyl(methyl)sulfamoyl]-N-ethyl-1,1-dioxothiolan-3-amine |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-3-16(14-9-10-21(17,18)12-14)22(19,20)15(2)11-13-7-5-4-6-8-13/h4-8,14H,3,9-12H2,1-2H3 |
| InChIKey | KPSHEMKQFJZFTO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |