C12H14ClNO5S — CID 43578756
4-chloro-3-[cyclopropyl(2-hydroxyethyl)sulfamoyl]benzoic acid (PubChem CID 43578756) has the molecular formula C12H14ClNO5S and a molecular weight of 319.77 g/mol. Its IUPAC name is 4-chloro-3-[cyclopropyl(2-hydroxyethyl)sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[cyclopropyl(2-hydroxyethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 43578756 |
| Molecular Formula | C12H14ClNO5S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 4-chloro-3-[cyclopropyl(2-hydroxyethyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)N(CCO)C2CC2)c1 |
| InChI | InChI=1S/C12H14ClNO5S/c13-10-4-1-8(12(16)17)7-11(10)20(18,19)14(5-6-15)9-2-3-9/h1,4,7,9,15H,2-3,5-6H2,(H,16,17) |
| InChIKey | WOTLBDMKOVKMKJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |