C25H24Cl2N2O6S2 — CID 164663343
5-[benzyl-[4-(benzylamino)-1,1-dioxothiolan-3-yl]sulfamoyl]-2,4-dichlorobenzoic acid (PubChem CID 164663343) has the molecular formula C25H24Cl2N2O6S2 and a molecular weight of 583.52 g/mol. Its IUPAC name is 5-[benzyl-[4-(benzylamino)-1,1-dioxothiolan-3-yl]sulfamoyl]-2,4-dichlorobenzoic acid.
| Compound Name | 5-[benzyl-[4-(benzylamino)-1,1-dioxothiolan-3-yl]sulfamoyl]-2,4-dichlorobenzoic acid |
|---|---|
| PubChem CID | 164663343 |
| Molecular Formula | C25H24Cl2N2O6S2 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 5-[benzyl-[4-(benzylamino)-1,1-dioxothiolan-3-yl]sulfamoyl]-2,4-dichlorobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N(Cc2ccccc2)C2CS(=O)(=O)CC2NCc2ccccc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C25H24Cl2N2O6S2/c26-20-12-21(27)24(11-19(20)25(30)31)37(34,35)29(14-18-9-5-2-6-10-18)23-16-36(32,33)15-22(23)28-13-17-7-3-1-4-8-17/h1-12,22-23,28H,13-16H2,(H,30,31) |
| InChIKey | WYBLOUFWGYZRIU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |