C35H37Cl2N3O6S2 — CID 24828966
tert-butyl (3S,4S)-3,4-bis[benzyl-(2-chlorophenyl)sulfonylamino]pyrrolidine-1-carboxylate (PubChem CID 24828966) has the molecular formula C35H37Cl2N3O6S2 and a molecular weight of 730.74 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3,4-bis[benzyl-(2-chlorophenyl)sulfonylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3,4-bis[benzyl-(2-chlorophenyl)sulfonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24828966 |
| Molecular Formula | C35H37Cl2N3O6S2 |
| Molecular Weight | 730.74 g/mol |
| Exact Mass | 729.15 |
| IUPAC Name | tert-butyl (3S,4S)-3,4-bis[benzyl-(2-chlorophenyl)sulfonylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(Cc2ccccc2)S(=O)(=O)c2ccccc2Cl)[C@@H](N(Cc2ccccc2)S(=O)(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C35H37Cl2N3O6S2/c1-35(2,3)46-34(41)38-24-30(39(22-26-14-6-4-7-15-26)47(42,43)32-20-12-10-18-28(32)36)31(25-38)40(23-27-16-8-5-9-17-27)48(44,45)33-21-13-11-19-29(33)37/h4-21,30-31H,22-25H2,1-3H3/t30-,31-/m0/s1 |
| InChIKey | ZWNVTVGNZUDITI-CONSDPRKSA-N |
| XLogP | 7.06 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |