C27H35N3O6S2 — CID 24828285
tert-butyl (3S,4S)-3,4-bis[benzenesulfonyl(prop-2-enyl)amino]pyrrolidine-1-carboxylate (PubChem CID 24828285) has the molecular formula C27H35N3O6S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3,4-bis[benzenesulfonyl(prop-2-enyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3,4-bis[benzenesulfonyl(prop-2-enyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24828285 |
| Molecular Formula | C27H35N3O6S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | tert-butyl (3S,4S)-3,4-bis[benzenesulfonyl(prop-2-enyl)amino]pyrrolidine-1-carboxylate |
| SMILES | C=CCN([C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1N(CC=C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H35N3O6S2/c1-6-18-29(37(32,33)22-14-10-8-11-15-22)24-20-28(26(31)36-27(3,4)5)21-25(24)30(19-7-2)38(34,35)23-16-12-9-13-17-23/h6-17,24-25H,1-2,18-21H2,3-5H3/t24-,25-/m0/s1 |
| InChIKey | UVDSMPVUUOAWBW-DQEYMECFSA-N |
| XLogP | 3.73 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|