C24H31N3O5S — CID 166637107
tert-butyl 4-(benzenesulfonyl)-3-[benzyl(methyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 166637107) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is tert-butyl 4-(benzenesulfonyl)-3-[benzyl(methyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(benzenesulfonyl)-3-[benzyl(methyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166637107 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | tert-butyl 4-(benzenesulfonyl)-3-[benzyl(methyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | CN(Cc1ccccc1)C(=O)C1CN(C(=O)OC(C)(C)C)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-24(2,3)32-23(29)26-15-16-27(33(30,31)20-13-9-6-10-14-20)21(18-26)22(28)25(4)17-19-11-7-5-8-12-19/h5-14,21H,15-18H2,1-4H3 |
| InChIKey | YYWWKPGTTYHGOG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |