C23H24F3N3O6S — CID 91115558
methyl 4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 91115558) has the molecular formula C23H24F3N3O6S and a molecular weight of 527.52 g/mol. Its IUPAC name is methyl 4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 91115558 |
| Molecular Formula | C23H24F3N3O6S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | methyl 4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCN(C(C)=O)CC2C(=O)N(Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3N3O6S/c1-16(30)27-12-13-29(36(33,34)19-10-8-18(9-11-19)22(32)35-2)20(15-27)21(31)28(23(24,25)26)14-17-6-4-3-5-7-17/h3-11,20H,12-15H2,1-2H3 |
| InChIKey | IBYCFTWKGJYNOR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|