C21H26N4O6S — CID 10389610
1-N-benzyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-N-methylpiperazine-1,3-dicarboxamide (PubChem CID 10389610) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is 1-N-benzyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-N-methylpiperazine-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-N-methylpiperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10389610 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1-N-benzyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-N-methylpiperazine-1,3-dicarboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)N(C)Cc3ccccc3)CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C21H26N4O6S/c1-23(14-16-6-4-3-5-7-16)21(27)24-12-13-25(19(15-24)20(26)22-28)32(29,30)18-10-8-17(31-2)9-11-18/h3-11,19,28H,12-15H2,1-2H3,(H,22,26) |
| InChIKey | SJJAJPMVTRAZSX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|